About 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide
6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide (PubChem CID 131218663) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide |
| PubChem CID | 131218663 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(NCC)nc1C |
| InChI | InChI=1S/C10H16N4/c1-4-13-8-5-6(2)9(10(11)12)7(3)14-8/h5H,4H2,1-3H3,(H3,11,12)(H,13,14) |
| InChIKey | SAJUYAKFIULHPT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide?
The IUPAC name of 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide (CID 131218663) is 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide.
What is the SMILES notation for 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide?
The canonical SMILES for 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide is [H]/N=C(\N)c1c(C)cc(NCC)nc1C.
What is the InChIKey of 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide?
The InChIKey is SAJUYAKFIULHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-4-13-8-5-6(2)9(10(11)12)7(3)14-8/h5H,4H2,1-3H3,(H3,11,12)(H,13,14).
What are the key properties of 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide?
6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide has a molecular weight of 192.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylamino)-2,4-dimethylpyridine-3-carboximidamide is sourced from PubChem (CID 131218663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).