C9H3F2NS — CID 131219396
6,7-difluoro-1-benzothiophene-5-carbonitrile (PubChem CID 131219396) has the molecular formula C9H3F2NS and a molecular weight of 195.19 g/mol. Its IUPAC name is 6,7-difluoro-1-benzothiophene-5-carbonitrile.
| Compound Name | 6,7-difluoro-1-benzothiophene-5-carbonitrile |
|---|---|
| PubChem CID | 131219396 |
| Molecular Formula | C9H3F2NS |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 6,7-difluoro-1-benzothiophene-5-carbonitrile |
| SMILES | N#Cc1cc2ccsc2c(F)c1F |
| InChI | InChI=1S/C9H3F2NS/c10-7-6(4-12)3-5-1-2-13-9(5)8(7)11/h1-3H |
| InChIKey | ITYADCSTHBEMMT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |