About 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole
5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole (PubChem CID 131219533) has the molecular formula C8H10ClNO3S
and a molecular weight of 235.69 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole.
Molecular Properties
| Compound Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole |
| PubChem CID | 131219533 |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole |
| SMILES | COc1cc(C2OCC(CCl)O2)sn1 |
| InChI | InChI=1S/C8H10ClNO3S/c1-11-7-2-6(14-10-7)8-12-4-5(3-9)13-8/h2,5,8H,3-4H2,1H3 |
| InChIKey | VFUNUCKRYQSSTE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole?
The IUPAC name of 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole (CID 131219533) is 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole.
What is the SMILES notation for 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole?
The canonical SMILES for 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole is COc1cc(C2OCC(CCl)O2)sn1.
What is the InChIKey of 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole?
The InChIKey is VFUNUCKRYQSSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO3S/c1-11-7-2-6(14-10-7)8-12-4-5(3-9)13-8/h2,5,8H,3-4H2,1H3.
What are the key properties of 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole?
5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole has a molecular weight of 235.69 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-3-methoxy-1,2-thiazole is sourced from PubChem (CID 131219533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).