About 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine (PubChem CID 13121962) has the molecular formula C9H15ClN2S
and a molecular weight of 218.75 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 13121962 |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.75 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H15ClN2S/c1-12(2)5-3-4-9-11-8(6-10)7-13-9/h7H,3-6H2,1-2H3 |
| InChIKey | HOTPGQSPORZNLJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine (CID 13121962) is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCc1nc(CCl)cs1.
What is the InChIKey of 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is HOTPGQSPORZNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2S/c1-12(2)5-3-4-9-11-8(6-10)7-13-9/h7H,3-6H2,1-2H3.
What are the key properties of 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine?
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 218.75 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 13121962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).