About 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine
3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 131219759) has the molecular formula C5H10N4S2
and a molecular weight of 190.30 g/mol. Its IUPAC name is 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| PubChem CID | 131219759 |
| Molecular Formula | C5H10N4S2 |
| Molecular Weight | 190.30 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCSCSc1n[nH]c(N)n1 |
| InChI | InChI=1S/C5H10N4S2/c1-2-10-3-11-5-7-4(6)8-9-5/h2-3H2,1H3,(H3,6,7,8,9) |
| InChIKey | AGTGZULNKQIGHY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine (CID 131219759) is 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine is CCSCSc1n[nH]c(N)n1.
What is the InChIKey of 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine?
The InChIKey is AGTGZULNKQIGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S2/c1-2-10-3-11-5-7-4(6)8-9-5/h2-3H2,1H3,(H3,6,7,8,9).
What are the key properties of 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine?
3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine has a molecular weight of 190.30 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylsulfanylmethylsulfanyl)-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 131219759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).