C6H11F2NO2 — CID 131222905
2,2-difluoro-N-[(2S)-4-hydroxybutan-2-yl]acetamide (PubChem CID 131222905) has the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2S)-4-hydroxybutan-2-yl]acetamide.
| Compound Name | 2,2-difluoro-N-[(2S)-4-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 131222905 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2,2-difluoro-N-[(2S)-4-hydroxybutan-2-yl]acetamide |
| SMILES | C[C@@H](CCO)NC(=O)C(F)F |
| InChI | InChI=1S/C6H11F2NO2/c1-4(2-3-10)9-6(11)5(7)8/h4-5,10H,2-3H2,1H3,(H,9,11)/t4-/m0/s1 |
| InChIKey | BHVGZVYASBWPDU-BYPYZUCNSA-N |
| XLogP | 0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |