About 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride
2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride (PubChem CID 131224139) has the molecular formula C8H19ClN2S
and a molecular weight of 210.77 g/mol. Its IUPAC name is 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride |
| PubChem CID | 131224139 |
| Molecular Formula | C8H19ClN2S |
| Molecular Weight | 210.77 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride |
| SMILES | CC(C)CS/C(N)=N\C(C)C.Cl |
| InChI | InChI=1S/C8H18N2S.ClH/c1-6(2)5-11-8(9)10-7(3)4;/h6-7H,5H2,1-4H3,(H2,9,10);1H |
| InChIKey | VALAZOKLHSVVLP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride?
The IUPAC name of 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride (CID 131224139) is 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride.
What is the SMILES notation for 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride?
The canonical SMILES for 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride is CC(C)CS/C(N)=N\C(C)C.Cl.
What is the InChIKey of 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride?
The InChIKey is VALAZOKLHSVVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2S.ClH/c1-6(2)5-11-8(9)10-7(3)4;/h6-7H,5H2,1-4H3,(H2,9,10);1H.
What are the key properties of 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride?
2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride has a molecular weight of 210.77 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N'-propan-2-ylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 131224139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).