C8H14INO — CID 131227340
cis-(1R,2R)-2-ethyl-N-(2-iodoethyl)cyclopropane-1-carboxamide (PubChem CID 131227340) has the molecular formula C8H14INO and a molecular weight of 267.11 g/mol. Its IUPAC name is cis-(1R,2R)-2-ethyl-N-(2-iodoethyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-ethyl-N-(2-iodoethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 131227340 |
| Molecular Formula | C8H14INO |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | cis-(1R,2R)-2-ethyl-N-(2-iodoethyl)cyclopropane-1-carboxamide |
| SMILES | CC[C@@H]1C[C@H]1C(=O)NCCI |
| InChI | InChI=1S/C8H14INO/c1-2-6-5-7(6)8(11)10-4-3-9/h6-7H,2-5H2,1H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | CLQJRQHVVUOWRV-RNFRBKRXSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|