About methyl 2-pyridin-4-ylpropanoate
methyl 2-pyridin-4-ylpropanoate (PubChem CID 13122749) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 2-pyridin-4-ylpropanoate.
Molecular Properties
| Compound Name | methyl 2-pyridin-4-ylpropanoate |
| PubChem CID | 13122749 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 2-pyridin-4-ylpropanoate |
| SMILES | COC(=O)C(C)c1ccncc1 |
| InChI | InChI=1S/C9H11NO2/c1-7(9(11)12-2)8-3-5-10-6-4-8/h3-7H,1-2H3 |
| InChIKey | VSXNIZYHQLWKTA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-pyridin-4-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyridin-4-ylpropanoate?
The IUPAC name of methyl 2-pyridin-4-ylpropanoate (CID 13122749) is methyl 2-pyridin-4-ylpropanoate.
What is the SMILES notation for methyl 2-pyridin-4-ylpropanoate?
The canonical SMILES for methyl 2-pyridin-4-ylpropanoate is COC(=O)C(C)c1ccncc1.
What is the InChIKey of methyl 2-pyridin-4-ylpropanoate?
The InChIKey is VSXNIZYHQLWKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7(9(11)12-2)8-3-5-10-6-4-8/h3-7H,1-2H3.
What are the key properties of methyl 2-pyridin-4-ylpropanoate?
methyl 2-pyridin-4-ylpropanoate has a molecular weight of 165.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyridin-4-ylpropanoate is sourced from PubChem (CID 13122749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).