About 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol
2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol (PubChem CID 131227512) has the molecular formula C6H10N2OS2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol.
Molecular Properties
| Compound Name | 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol |
| PubChem CID | 131227512 |
| Molecular Formula | C6H10N2OS2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol |
| SMILES | CC(CO)SCc1cnsn1 |
| InChI | InChI=1S/C6H10N2OS2/c1-5(3-9)10-4-6-2-7-11-8-6/h2,5,9H,3-4H2,1H3 |
| InChIKey | XIGVDBKJQWICGY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol?
The IUPAC name of 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol (CID 131227512) is 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol.
What is the SMILES notation for 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol?
The canonical SMILES for 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol is CC(CO)SCc1cnsn1.
What is the InChIKey of 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol?
The InChIKey is XIGVDBKJQWICGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS2/c1-5(3-9)10-4-6-2-7-11-8-6/h2,5,9H,3-4H2,1H3.
What are the key properties of 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol?
2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol has a molecular weight of 190.29 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,5-thiadiazol-3-ylmethylsulfanyl)propan-1-ol is sourced from PubChem (CID 131227512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).