C7H13F2NO — CID 131229680
1-(2,2-difluoroethyl)-2-(methoxymethyl)azetidine (PubChem CID 131229680) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(methoxymethyl)azetidine.
| Compound Name | 1-(2,2-difluoroethyl)-2-(methoxymethyl)azetidine |
|---|---|
| PubChem CID | 131229680 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(methoxymethyl)azetidine |
| SMILES | COCC1CCN1CC(F)F |
| InChI | InChI=1S/C7H13F2NO/c1-11-5-6-2-3-10(6)4-7(8)9/h6-7H,2-5H2,1H3 |
| InChIKey | NGGLZBRGLWPIBV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |