About 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid
2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid (PubChem CID 131230231) has the molecular formula C6H12N2O2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid |
| PubChem CID | 131230231 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid |
| SMILES | CC(C)/N=C(/N)SCC(=O)O |
| InChI | InChI=1S/C6H12N2O2S/c1-4(2)8-6(7)11-3-5(9)10/h4H,3H2,1-2H3,(H2,7,8)(H,9,10) |
| InChIKey | RAAFKEMFEXKFIJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid?
The IUPAC name of 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid (CID 131230231) is 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid.
What is the SMILES notation for 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid?
The canonical SMILES for 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid is CC(C)/N=C(/N)SCC(=O)O.
What is the InChIKey of 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid?
The InChIKey is RAAFKEMFEXKFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S/c1-4(2)8-6(7)11-3-5(9)10/h4H,3H2,1-2H3,(H2,7,8)(H,9,10).
What are the key properties of 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid?
2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid has a molecular weight of 176.24 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-propan-2-ylcarbamimidoyl)sulfanylacetic acid is sourced from PubChem (CID 131230231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).