C10H18O — CID 131230710
(4R,5R)-5,7-dimethylocta-1,6-dien-4-ol (PubChem CID 131230710) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (4R,5R)-5,7-dimethylocta-1,6-dien-4-ol.
| Compound Name | (4R,5R)-5,7-dimethylocta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 131230710 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (4R,5R)-5,7-dimethylocta-1,6-dien-4-ol |
| SMILES | C=CC[C@@H](O)[C@H](C)C=C(C)C |
| InChI | InChI=1S/C10H18O/c1-5-6-10(11)9(4)7-8(2)3/h5,7,9-11H,1,6H2,2-4H3/t9-,10-/m1/s1 |
| InChIKey | YUZDFABLZOIMJO-NXEZZACHSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|