C10H16O — CID 131231505
(2S,3R,5S)-5-butylspiro[2.2]pentane-2-carbaldehyde (PubChem CID 131231505) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S,3R,5S)-5-butylspiro[2.2]pentane-2-carbaldehyde.
| Compound Name | (2S,3R,5S)-5-butylspiro[2.2]pentane-2-carbaldehyde |
|---|---|
| PubChem CID | 131231505 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2S,3R,5S)-5-butylspiro[2.2]pentane-2-carbaldehyde |
| SMILES | CCCC[C@H]1C[C@@]12C[C@@H]2C=O |
| InChI | InChI=1S/C10H16O/c1-2-3-4-8-5-10(8)6-9(10)7-11/h7-9H,2-6H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | AHGMMHGVWUUYLG-IVZWLZJFSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|