C12H14O7 — CID 13123157
dimethyl (3aR,4R,6aR)-2,6a-dimethyl-5-oxo-3a,4-dihydrofuro[2,3-b]furan-3,4-dicarboxylate (PubChem CID 13123157) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is dimethyl (3aR,4R,6aR)-2,6a-dimethyl-5-oxo-3a,4-dihydrofuro[2,3-b]furan-3,4-dicarboxylate.
| Compound Name | dimethyl (3aR,4R,6aR)-2,6a-dimethyl-5-oxo-3a,4-dihydrofuro[2,3-b]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 13123157 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | dimethyl (3aR,4R,6aR)-2,6a-dimethyl-5-oxo-3a,4-dihydrofuro[2,3-b]furan-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C)O[C@]2(C)OC(=O)[C@@H](C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C12H14O7/c1-5-6(9(13)16-3)8-7(10(14)17-4)11(15)19-12(8,2)18-5/h7-8H,1-4H3/t7-,8+,12-/m1/s1 |
| InChIKey | VVFZKJOFPTXDCO-RGNHYFCHSA-N |
| XLogP | 0.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|