C9H15NO2 — CID 131231878
(E)-N-[(1R,2R)-2-hydroxycyclobutyl]pent-2-enamide (PubChem CID 131231878) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (E)-N-[(1R,2R)-2-hydroxycyclobutyl]pent-2-enamide.
| Compound Name | (E)-N-[(1R,2R)-2-hydroxycyclobutyl]pent-2-enamide |
|---|---|
| PubChem CID | 131231878 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (E)-N-[(1R,2R)-2-hydroxycyclobutyl]pent-2-enamide |
| SMILES | CC/C=C/C(=O)N[C@@H]1CC[C@H]1O |
| InChI | InChI=1S/C9H15NO2/c1-2-3-4-9(12)10-7-5-6-8(7)11/h3-4,7-8,11H,2,5-6H2,1H3,(H,10,12)/b4-3+/t7-,8-/m1/s1 |
| InChIKey | JDEZHLOMRRSDLE-ATXJSMISSA-N |
| XLogP | 0.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|