C8H14ClNO2 — CID 131231907
(3S,4R)-1-[(E)-3-chloroprop-2-enyl]piperidine-3,4-diol (PubChem CID 131231907) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is (3S,4R)-1-[(E)-3-chloroprop-2-enyl]piperidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(E)-3-chloroprop-2-enyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 131231907 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (3S,4R)-1-[(E)-3-chloroprop-2-enyl]piperidine-3,4-diol |
| SMILES | O[C@@H]1CCN(C/C=C/Cl)C[C@@H]1O |
| InChI | InChI=1S/C8H14ClNO2/c9-3-1-4-10-5-2-7(11)8(12)6-10/h1,3,7-8,11-12H,2,4-6H2/b3-1+/t7-,8+/m1/s1 |
| InChIKey | UHZMDDDUVZMOLE-CWGGMDLJSA-N |
| XLogP | 0.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |