C9H14N4 — CID 131232681
5-[(E)-but-2-enyl]-2,4,6,7-tetrahydrotriazolo[4,5-c]pyridine (PubChem CID 131232681) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-2,4,6,7-tetrahydrotriazolo[4,5-c]pyridine.
| Compound Name | 5-[(E)-but-2-enyl]-2,4,6,7-tetrahydrotriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 131232681 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-[(E)-but-2-enyl]-2,4,6,7-tetrahydrotriazolo[4,5-c]pyridine |
| SMILES | C/C=C/CN1CCc2n[nH]nc2C1 |
| InChI | InChI=1S/C9H14N4/c1-2-3-5-13-6-4-8-9(7-13)11-12-10-8/h2-3H,4-7H2,1H3,(H,10,11,12)/b3-2+ |
| InChIKey | SRGVUPBWZRSVBD-NSCUHMNNSA-N |
| XLogP | 0.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|