About 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine
1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine (PubChem CID 131232946) has the molecular formula C10H19ClN2
and a molecular weight of 202.73 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine |
| PubChem CID | 131232946 |
| Molecular Formula | C10H19ClN2 |
| Molecular Weight | 202.73 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine |
| SMILES | CC1C(C)N(C/C=C/Cl)CCN1C |
| InChI | InChI=1S/C10H19ClN2/c1-9-10(2)13(6-4-5-11)8-7-12(9)3/h4-5,9-10H,6-8H2,1-3H3/b5-4+ |
| InChIKey | JEBXKSYOKZZIJV-SNAWJCMRSA-N |
| XLogP | 1.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine?
The IUPAC name of 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine (CID 131232946) is 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine.
What is the SMILES notation for 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine?
The canonical SMILES for 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine is CC1C(C)N(C/C=C/Cl)CCN1C.
What is the InChIKey of 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine?
The InChIKey is JEBXKSYOKZZIJV-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H19ClN2/c1-9-10(2)13(6-4-5-11)8-7-12(9)3/h4-5,9-10H,6-8H2,1-3H3/b5-4+.
What are the key properties of 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine?
1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine has a molecular weight of 202.73 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-chloroprop-2-enyl]-2,3,4-trimethylpiperazine is sourced from PubChem (CID 131232946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).