About ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate
ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate (PubChem CID 131232981) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate.
Molecular Properties
| Compound Name | ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate |
| PubChem CID | 131232981 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate |
| SMILES | CCOC(=O)N=c1sccn1C |
| InChI | InChI=1S/C7H10N2O2S/c1-3-11-7(10)8-6-9(2)4-5-12-6/h4-5H,3H2,1-2H3 |
| InChIKey | ZIOWZQJPIRAUJV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate?
The IUPAC name of ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate (CID 131232981) is ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate.
What is the SMILES notation for ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate?
The canonical SMILES for ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate is CCOC(=O)N=c1sccn1C.
What is the InChIKey of ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate?
The InChIKey is ZIOWZQJPIRAUJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-3-11-7(10)8-6-9(2)4-5-12-6/h4-5H,3H2,1-2H3.
What are the key properties of ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate?
ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate has a molecular weight of 186.24 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(3-methyl-1,3-thiazol-2-ylidene)carbamate is sourced from PubChem (CID 131232981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).