About (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one
(E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one (PubChem CID 131233247) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one |
| PubChem CID | 131233247 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCOCC(C)C1 |
| InChI | InChI=1S/C10H17NO2/c1-3-4-10(12)11-5-6-13-8-9(2)7-11/h3-4,9H,5-8H2,1-2H3/b4-3+ |
| InChIKey | MCEFRAXBJQDTFO-ONEGZZNKSA-N |
| XLogP | 1.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one?
The IUPAC name of (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one (CID 131233247) is (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one.
What is the SMILES notation for (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one?
The canonical SMILES for (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one is C/C=C/C(=O)N1CCOCC(C)C1.
What is the InChIKey of (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one?
The InChIKey is MCEFRAXBJQDTFO-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-4-10(12)11-5-6-13-8-9(2)7-11/h3-4,9H,5-8H2,1-2H3/b4-3+.
What are the key properties of (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one?
(E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one has a molecular weight of 183.25 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(6-methyl-1,4-oxazepan-4-yl)but-2-en-1-one is sourced from PubChem (CID 131233247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).