About 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide
4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide (PubChem CID 131233873) has the molecular formula C10H19NOS
and a molecular weight of 201.33 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide.
Molecular Properties
| Compound Name | 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide |
| PubChem CID | 131233873 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide |
| SMILES | C/C=C/CN1CCC(C)S(=O)CC1 |
| InChI | InChI=1S/C10H19NOS/c1-3-4-6-11-7-5-10(2)13(12)9-8-11/h3-4,10H,5-9H2,1-2H3/b4-3+ |
| InChIKey | UUFGTZVKKOZQJE-ONEGZZNKSA-N |
| XLogP | 1.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide?
The IUPAC name of 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide (CID 131233873) is 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide.
What is the SMILES notation for 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide?
The canonical SMILES for 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide is C/C=C/CN1CCC(C)S(=O)CC1.
What is the InChIKey of 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide?
The InChIKey is UUFGTZVKKOZQJE-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H19NOS/c1-3-4-6-11-7-5-10(2)13(12)9-8-11/h3-4,10H,5-9H2,1-2H3/b4-3+.
What are the key properties of 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide?
4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide has a molecular weight of 201.33 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-but-2-enyl]-7-methyl-1,4-thiazepane 1-oxide is sourced from PubChem (CID 131233873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).