C7H12ClNOS — CID 131233951
4-[(E)-3-chloroprop-2-enyl]-1,4-thiazinane 1-oxide (PubChem CID 131233951) has the molecular formula C7H12ClNOS and a molecular weight of 193.70 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[(E)-3-chloroprop-2-enyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 131233951 |
| Molecular Formula | C7H12ClNOS |
| Molecular Weight | 193.70 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enyl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(C/C=C/Cl)CC1 |
| InChI | InChI=1S/C7H12ClNOS/c8-2-1-3-9-4-6-11(10)7-5-9/h1-2H,3-7H2/b2-1+ |
| InChIKey | ZXUWCAPYJTVCDG-OWOJBTEDSA-N |
| XLogP | 0.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.70 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |