C8H8N2O4 — CID 131234014
5-[(E)-3-oxobut-1-enyl]-1,3-diazinane-2,4,6-trione (PubChem CID 131234014) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 5-[(E)-3-oxobut-1-enyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-oxobut-1-enyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 131234014 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-[(E)-3-oxobut-1-enyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)/C=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H8N2O4/c1-4(11)2-3-5-6(12)9-8(14)10-7(5)13/h2-3,5H,1H3,(H2,9,10,12,13,14)/b3-2+ |
| InChIKey | XSLILPVGWBVPJQ-NSCUHMNNSA-N |
| XLogP | -0.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|