About 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane
1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane (PubChem CID 131234517) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane |
| PubChem CID | 131234517 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane |
| SMILES | CC1CN(C/C=C/C2CC2)CCCN1 |
| InChI | InChI=1S/C12H22N2/c1-11-10-14(9-3-7-13-11)8-2-4-12-5-6-12/h2,4,11-13H,3,5-10H2,1H3/b4-2+ |
| InChIKey | RPJSEPBTEQDBKN-DUXPYHPUSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane?
The IUPAC name of 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane (CID 131234517) is 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane.
What is the SMILES notation for 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane?
The canonical SMILES for 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane is CC1CN(C/C=C/C2CC2)CCCN1.
What is the InChIKey of 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane?
The InChIKey is RPJSEPBTEQDBKN-DUXPYHPUSA-N. The full InChI is InChI=1S/C12H22N2/c1-11-10-14(9-3-7-13-11)8-2-4-12-5-6-12/h2,4,11-13H,3,5-10H2,1H3/b4-2+.
What are the key properties of 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane?
1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane has a molecular weight of 194.32 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-cyclopropylprop-2-enyl]-3-methyl-1,4-diazepane is sourced from PubChem (CID 131234517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).