About 2-[(E)-but-2-enyl]-1,3-dihydroisoindole
2-[(E)-but-2-enyl]-1,3-dihydroisoindole (PubChem CID 131234693) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enyl]-1,3-dihydroisoindole |
| PubChem CID | 131234693 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-[(E)-but-2-enyl]-1,3-dihydroisoindole |
| SMILES | C/C=C/CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H15N/c1-2-3-8-13-9-11-6-4-5-7-12(11)10-13/h2-7H,8-10H2,1H3/b3-2+ |
| InChIKey | OEAZVKUZGOVSSG-NSCUHMNNSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enyl]-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enyl]-1,3-dihydroisoindole?
The IUPAC name of 2-[(E)-but-2-enyl]-1,3-dihydroisoindole (CID 131234693) is 2-[(E)-but-2-enyl]-1,3-dihydroisoindole.
What is the SMILES notation for 2-[(E)-but-2-enyl]-1,3-dihydroisoindole?
The canonical SMILES for 2-[(E)-but-2-enyl]-1,3-dihydroisoindole is C/C=C/CN1Cc2ccccc2C1.
What is the InChIKey of 2-[(E)-but-2-enyl]-1,3-dihydroisoindole?
The InChIKey is OEAZVKUZGOVSSG-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H15N/c1-2-3-8-13-9-11-6-4-5-7-12(11)10-13/h2-7H,8-10H2,1H3/b3-2+.
What are the key properties of 2-[(E)-but-2-enyl]-1,3-dihydroisoindole?
2-[(E)-but-2-enyl]-1,3-dihydroisoindole has a molecular weight of 173.26 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enyl]-1,3-dihydroisoindole is sourced from PubChem (CID 131234693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).