About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline (PubChem CID 13123527) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline |
| PubChem CID | 13123527 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline |
| SMILES | Cc1ccc(NCC2=NCCN2)cc1 |
| InChI | InChI=1S/C11H15N3/c1-9-2-4-10(5-3-9)14-8-11-12-6-7-13-11/h2-5,14H,6-8H2,1H3,(H,12,13) |
| InChIKey | DUWYZPORHIKSDF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline (CID 13123527) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline is Cc1ccc(NCC2=NCCN2)cc1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline?
The InChIKey is DUWYZPORHIKSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-9-2-4-10(5-3-9)14-8-11-12-6-7-13-11/h2-5,14H,6-8H2,1H3,(H,12,13).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline has a molecular weight of 189.26 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylaniline is sourced from PubChem (CID 13123527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).