About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline (PubChem CID 13123529) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline |
| PubChem CID | 13123529 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)CC2=NCCN2)cc1 |
| InChI | InChI=1S/C12H17N3/c1-10-3-5-11(6-4-10)15(2)9-12-13-7-8-14-12/h3-6H,7-9H2,1-2H3,(H,13,14) |
| InChIKey | PMFDJWPQFXVNQB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline (CID 13123529) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline is Cc1ccc(N(C)CC2=NCCN2)cc1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline?
The InChIKey is PMFDJWPQFXVNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-10-3-5-11(6-4-10)15(2)9-12-13-7-8-14-12/h3-6H,7-9H2,1-2H3,(H,13,14).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline has a molecular weight of 203.29 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N,4-dimethylaniline is sourced from PubChem (CID 13123529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).