About 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline
2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (PubChem CID 13123534) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| PubChem CID | 13123534 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| SMILES | Clc1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C10H12ClN3/c11-8-3-1-2-4-9(8)14-7-10-12-5-6-13-10/h1-4,14H,5-7H2,(H,12,13) |
| InChIKey | DYFUNGBOKHWQAJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The IUPAC name of 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (CID 13123534) is 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
What is the SMILES notation for 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The canonical SMILES for 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is Clc1ccccc1NCC1=NCCN1.
What is the InChIKey of 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The InChIKey is DYFUNGBOKHWQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c11-8-3-1-2-4-9(8)14-7-10-12-5-6-13-10/h1-4,14H,5-7H2,(H,12,13).
What are the key properties of 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline has a molecular weight of 209.68 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is sourced from PubChem (CID 13123534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).