C9H6Cl2FNO — CID 131235842
(E)-3-(2,3-dichloro-6-fluorophenyl)prop-2-enamide (PubChem CID 131235842) has the molecular formula C9H6Cl2FNO and a molecular weight of 234.06 g/mol. Its IUPAC name is (E)-3-(2,3-dichloro-6-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichloro-6-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 131235842 |
| Molecular Formula | C9H6Cl2FNO |
| Molecular Weight | 234.06 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | (E)-3-(2,3-dichloro-6-fluorophenyl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl2FNO/c10-6-2-3-7(12)5(9(6)11)1-4-8(13)14/h1-4H,(H2,13,14)/b4-1+ |
| InChIKey | ZHBSEPOGKWQKQL-DAFODLJHSA-N |
| XLogP | 2.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.06 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|