About 2-methoxy-3,5-diphenylpyrazine
2-methoxy-3,5-diphenylpyrazine (PubChem CID 13123633) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-methoxy-3,5-diphenylpyrazine.
Molecular Properties
| Compound Name | 2-methoxy-3,5-diphenylpyrazine |
| PubChem CID | 13123633 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-methoxy-3,5-diphenylpyrazine |
| SMILES | COc1ncc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H14N2O/c1-20-17-16(14-10-6-3-7-11-14)19-15(12-18-17)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | BZYQKRBJKFCIKJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-3,5-diphenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,5-diphenylpyrazine?
The IUPAC name of 2-methoxy-3,5-diphenylpyrazine (CID 13123633) is 2-methoxy-3,5-diphenylpyrazine.
What is the SMILES notation for 2-methoxy-3,5-diphenylpyrazine?
The canonical SMILES for 2-methoxy-3,5-diphenylpyrazine is COc1ncc(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 2-methoxy-3,5-diphenylpyrazine?
The InChIKey is BZYQKRBJKFCIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c1-20-17-16(14-10-6-3-7-11-14)19-15(12-18-17)13-8-4-2-5-9-13/h2-12H,1H3.
What are the key properties of 2-methoxy-3,5-diphenylpyrazine?
2-methoxy-3,5-diphenylpyrazine has a molecular weight of 262.31 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,5-diphenylpyrazine is sourced from PubChem (CID 13123633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).