About (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide
(E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide (PubChem CID 131237361) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide |
| PubChem CID | 131237361 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NCC1=CCCOC1 |
| InChI | InChI=1S/C10H15NO2/c1-2-4-10(12)11-7-9-5-3-6-13-8-9/h2,4-5H,3,6-8H2,1H3,(H,11,12)/b4-2+ |
| InChIKey | CBFQCDAQVFUYFM-DUXPYHPUSA-N |
| XLogP | 1.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide?
The IUPAC name of (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide (CID 131237361) is (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide.
What is the SMILES notation for (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide?
The canonical SMILES for (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide is C/C=C/C(=O)NCC1=CCCOC1.
What is the InChIKey of (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide?
The InChIKey is CBFQCDAQVFUYFM-DUXPYHPUSA-N. The full InChI is InChI=1S/C10H15NO2/c1-2-4-10(12)11-7-9-5-3-6-13-8-9/h2,4-5H,3,6-8H2,1H3,(H,11,12)/b4-2+.
What are the key properties of (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide?
(E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide has a molecular weight of 181.23 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3,6-dihydro-2H-pyran-5-ylmethyl)but-2-enamide is sourced from PubChem (CID 131237361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).