About (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile
(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile (PubChem CID 131238658) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile |
| PubChem CID | 131238658 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cnn(C)c1/C=C/C#N |
| InChI | InChI=1S/C8H9N3/c1-7-6-10-11(2)8(7)4-3-5-9/h3-4,6H,1-2H3/b4-3+ |
| InChIKey | XLIMDLDHVXUASQ-ONEGZZNKSA-N |
| XLogP | 1.27 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile?
The IUPAC name of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile (CID 131238658) is (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile.
What is the SMILES notation for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile?
The canonical SMILES for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile is Cc1cnn(C)c1/C=C/C#N.
What is the InChIKey of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile?
The InChIKey is XLIMDLDHVXUASQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H9N3/c1-7-6-10-11(2)8(7)4-3-5-9/h3-4,6H,1-2H3/b4-3+.
What are the key properties of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile?
(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile has a molecular weight of 147.18 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enenitrile is sourced from PubChem (CID 131238658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).