About 4-ethyl-2,4-dimethylmorpholin-4-ium
4-ethyl-2,4-dimethylmorpholin-4-ium (PubChem CID 13123889) has the molecular formula C8H18NO+
and a molecular weight of 144.24 g/mol. Its IUPAC name is 4-ethyl-2,4-dimethylmorpholin-4-ium.
Molecular Properties
| Compound Name | 4-ethyl-2,4-dimethylmorpholin-4-ium |
| PubChem CID | 13123889 |
| Molecular Formula | C8H18NO+ |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 4-ethyl-2,4-dimethylmorpholin-4-ium |
| SMILES | CC[N+]1(C)CCOC(C)C1 |
| InChI | InChI=1S/C8H18NO/c1-4-9(3)5-6-10-8(2)7-9/h8H,4-7H2,1-3H3/q+1 |
| InChIKey | SCBMKUYARXMUKB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,4-dimethylmorpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,4-dimethylmorpholin-4-ium?
The IUPAC name of 4-ethyl-2,4-dimethylmorpholin-4-ium (CID 13123889) is 4-ethyl-2,4-dimethylmorpholin-4-ium.
What is the SMILES notation for 4-ethyl-2,4-dimethylmorpholin-4-ium?
The canonical SMILES for 4-ethyl-2,4-dimethylmorpholin-4-ium is CC[N+]1(C)CCOC(C)C1.
What is the InChIKey of 4-ethyl-2,4-dimethylmorpholin-4-ium?
The InChIKey is SCBMKUYARXMUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO/c1-4-9(3)5-6-10-8(2)7-9/h8H,4-7H2,1-3H3/q+1.
What are the key properties of 4-ethyl-2,4-dimethylmorpholin-4-ium?
4-ethyl-2,4-dimethylmorpholin-4-ium has a molecular weight of 144.24 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,4-dimethylmorpholin-4-ium is sourced from PubChem (CID 13123889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).