(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid

C6H7F3O2 — CID 131239219

IUPAC(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid
SMILESCC(/C=C/C(=O)O)C(F)(F)F
InChIInChI=1S/C6H7F3O2/c1-4(6(7,8)9)2-3-5(10)11/h2-4H,1H3,(H,10,11)/b3-2+
InChIKeyDEMWVAJTOGUPOO-NSCUHMNNSA-N
MW168.11 g/mol
LogP1.83
Rot. Bonds2

About (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid

(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid (PubChem CID 131239219) has the molecular formula C6H7F3O2 and a molecular weight of 168.11 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid.

Molecular Properties

Compound Name(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid
PubChem CID131239219
Molecular FormulaC6H7F3O2
Molecular Weight168.11 g/mol
Exact Mass168.04
IUPAC Name(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid
SMILESCC(/C=C/C(=O)O)C(F)(F)F
InChIInChI=1S/C6H7F3O2/c1-4(6(7,8)9)2-3-5(10)11/h2-4H,1H3,(H,10,11)/b3-2+
InChIKeyDEMWVAJTOGUPOO-NSCUHMNNSA-N
XLogP1.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.11
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid?
The IUPAC name of (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid (CID 131239219) is (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid.
What is the SMILES notation for (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid?
The canonical SMILES for (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid is CC(/C=C/C(=O)O)C(F)(F)F.
What is the InChIKey of (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid?
The InChIKey is DEMWVAJTOGUPOO-NSCUHMNNSA-N. The full InChI is InChI=1S/C6H7F3O2/c1-4(6(7,8)9)2-3-5(10)11/h2-4H,1H3,(H,10,11)/b3-2+.
What are the key properties of (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid?
(E)-5,5,5-trifluoro-4-methylpent-2-enoic acid has a molecular weight of 168.11 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5,5-trifluoro-4-methylpent-2-enoic acid is sourced from PubChem (CID 131239219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).