About 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol
3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol (PubChem CID 131240617) has the molecular formula C9H7F3O
and a molecular weight of 188.15 g/mol. Its IUPAC name is 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol.
Molecular Properties
| Compound Name | 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol |
| PubChem CID | 131240617 |
| Molecular Formula | C9H7F3O |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol |
| SMILES | Oc1cccc(/C=C/C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O/c10-9(11,12)5-4-7-2-1-3-8(13)6-7/h1-6,13H/b5-4+ |
| InChIKey | PVORCAFENNXNRC-SNAWJCMRSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol?
The IUPAC name of 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol (CID 131240617) is 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol.
What is the SMILES notation for 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol?
The canonical SMILES for 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol is Oc1cccc(/C=C/C(F)(F)F)c1.
What is the InChIKey of 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol?
The InChIKey is PVORCAFENNXNRC-SNAWJCMRSA-N. The full InChI is InChI=1S/C9H7F3O/c10-9(11,12)5-4-7-2-1-3-8(13)6-7/h1-6,13H/b5-4+.
What are the key properties of 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol?
3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol has a molecular weight of 188.15 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3,3,3-trifluoroprop-1-enyl]phenol is sourced from PubChem (CID 131240617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).