C10H19NS — CID 131240922
4-[(E)-but-2-enyl]-2,6-dimethylthiomorpholine (PubChem CID 131240922) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-2,6-dimethylthiomorpholine.
| Compound Name | 4-[(E)-but-2-enyl]-2,6-dimethylthiomorpholine |
|---|---|
| PubChem CID | 131240922 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-[(E)-but-2-enyl]-2,6-dimethylthiomorpholine |
| SMILES | C/C=C/CN1CC(C)SC(C)C1 |
| InChI | InChI=1S/C10H19NS/c1-4-5-6-11-7-9(2)12-10(3)8-11/h4-5,9-10H,6-8H2,1-3H3/b5-4+ |
| InChIKey | LSVDGLPZBPLBLU-SNAWJCMRSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|