About 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine
4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine (PubChem CID 131240930) has the molecular formula C9H16ClNS
and a molecular weight of 205.75 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine |
| PubChem CID | 131240930 |
| Molecular Formula | C9H16ClNS |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(C/C=C/Cl)CCS1 |
| InChI | InChI=1S/C9H16ClNS/c1-9(2)8-11(5-3-4-10)6-7-12-9/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | RDHPYWYQEPKRBY-ONEGZZNKSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine?
The IUPAC name of 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine (CID 131240930) is 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine.
What is the SMILES notation for 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine?
The canonical SMILES for 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine is CC1(C)CN(C/C=C/Cl)CCS1.
What is the InChIKey of 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine?
The InChIKey is RDHPYWYQEPKRBY-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H16ClNS/c1-9(2)8-11(5-3-4-10)6-7-12-9/h3-4H,5-8H2,1-2H3/b4-3+.
What are the key properties of 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine?
4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine has a molecular weight of 205.75 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-chloroprop-2-enyl]-2,2-dimethylthiomorpholine is sourced from PubChem (CID 131240930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).