C11H19NO2 — CID 131241744
tert-butyl N-[(3R,4E)-hexa-1,4-dien-3-yl]carbamate (PubChem CID 131241744) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl N-[(3R,4E)-hexa-1,4-dien-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4E)-hexa-1,4-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 131241744 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | tert-butyl N-[(3R,4E)-hexa-1,4-dien-3-yl]carbamate |
| SMILES | C=C[C@H](/C=C/C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO2/c1-6-8-9(7-2)12-10(13)14-11(3,4)5/h6-9H,2H2,1,3-5H3,(H,12,13)/b8-6+/t9-/m1/s1 |
| InChIKey | SHZZUGFCIJQAGN-BNICOGTQSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|