C16H8Cl2F2N2OS — CID 1312422
N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 1312422) has the molecular formula C16H8Cl2F2N2OS and a molecular weight of 385.22 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 1312422 |
| Molecular Formula | C16H8Cl2F2N2OS |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H8Cl2F2N2OS/c17-9-5-4-8(6-10(9)18)13-7-24-16(21-13)22-15(23)14-11(19)2-1-3-12(14)20/h1-7H,(H,21,22,23) |
| InChIKey | OONXDYPWXXXOSV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |