C10H19ClN2OS — CID 131242459
(E)-N-(4-methylpiperidin-4-yl)-3-methylsulfanylprop-2-enamide;hydrochloride (PubChem CID 131242459) has the molecular formula C10H19ClN2OS and a molecular weight of 250.79 g/mol. Its IUPAC name is (E)-N-(4-methylpiperidin-4-yl)-3-methylsulfanylprop-2-enamide;hydrochloride.
| Compound Name | (E)-N-(4-methylpiperidin-4-yl)-3-methylsulfanylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 131242459 |
| Molecular Formula | C10H19ClN2OS |
| Molecular Weight | 250.79 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (E)-N-(4-methylpiperidin-4-yl)-3-methylsulfanylprop-2-enamide;hydrochloride |
| SMILES | CS/C=C/C(=O)NC1(C)CCNCC1.Cl |
| InChI | InChI=1S/C10H18N2OS.ClH/c1-10(4-6-11-7-5-10)12-9(13)3-8-14-2;/h3,8,11H,4-7H2,1-2H3,(H,12,13);1H/b8-3+; |
| InChIKey | FQJMAFCSUPXOON-DCDCITSCSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.79 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|