C24H17Cl2NO2 — CID 1312436
(3S)-5-(2,4-dichlorophenyl)-2,2-diphenyl-5-azaspiro[2.4]heptane-4,6-dione (PubChem CID 1312436) has the molecular formula C24H17Cl2NO2 and a molecular weight of 422.31 g/mol. Its IUPAC name is (3S)-5-(2,4-dichlorophenyl)-2,2-diphenyl-5-azaspiro[2.4]heptane-4,6-dione.
| Compound Name | (3S)-5-(2,4-dichlorophenyl)-2,2-diphenyl-5-azaspiro[2.4]heptane-4,6-dione |
|---|---|
| PubChem CID | 1312436 |
| Molecular Formula | C24H17Cl2NO2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (3S)-5-(2,4-dichlorophenyl)-2,2-diphenyl-5-azaspiro[2.4]heptane-4,6-dione |
| SMILES | O=C1C[C@]2(CC2(c2ccccc2)c2ccccc2)C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl2NO2/c25-18-11-12-20(19(26)13-18)27-21(28)14-23(22(27)29)15-24(23,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13H,14-15H2/t23-/m0/s1 |
| InChIKey | ALAPCKDLKCTPHK-QHCPKHFHSA-N |
| XLogP | 5.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|