C9H15NO2S — CID 131245261
(E)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylprop-2-en-1-one (PubChem CID 131245261) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (E)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylprop-2-en-1-one.
| Compound Name | (E)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 131245261 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (E)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylprop-2-en-1-one |
| SMILES | CS/C=C/C(=O)N1CCC(C)(O)C1 |
| InChI | InChI=1S/C9H15NO2S/c1-9(12)4-5-10(7-9)8(11)3-6-13-2/h3,6,12H,4-5,7H2,1-2H3/b6-3+ |
| InChIKey | VXOQUPJURIHZES-ZZXKWVIFSA-N |
| XLogP | 0.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|