C11H21ClN2O — CID 131245624
(E)-N-(azepan-4-yl)pent-2-enamide;hydrochloride (PubChem CID 131245624) has the molecular formula C11H21ClN2O and a molecular weight of 232.75 g/mol. Its IUPAC name is (E)-N-(azepan-4-yl)pent-2-enamide;hydrochloride.
| Compound Name | (E)-N-(azepan-4-yl)pent-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 131245624 |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (E)-N-(azepan-4-yl)pent-2-enamide;hydrochloride |
| SMILES | CC/C=C/C(=O)NC1CCCNCC1.Cl |
| InChI | InChI=1S/C11H20N2O.ClH/c1-2-3-6-11(14)13-10-5-4-8-12-9-7-10;/h3,6,10,12H,2,4-5,7-9H2,1H3,(H,13,14);1H/b6-3+; |
| InChIKey | ZSRCBSBLVQAGLU-ZIKNSQGESA-N |
| XLogP | 1.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|