C50H43N3O10S — CID 13124579
benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[[6-benzhydryloxy-5-(1,3-dioxoisoindol-2-yl)-6-oxohexanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 13124579) has the molecular formula C50H43N3O10S and a molecular weight of 877.97 g/mol. Its IUPAC name is benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[[6-benzhydryloxy-5-(1,3-dioxoisoindol-2-yl)-6-oxohexanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[[6-benzhydryloxy-5-(1,3-dioxoisoindol-2-yl)-6-oxohexanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 13124579 |
| Molecular Formula | C50H43N3O10S |
| Molecular Weight | 877.97 g/mol |
| Exact Mass | 877.27 |
| IUPAC Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[[6-benzhydryloxy-5-(1,3-dioxoisoindol-2-yl)-6-oxohexanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](NC(=O)CCCC(C(=O)OC(c3ccccc3)c3ccccc3)N3C(=O)c4ccccc4C3=O)[C@H]2SC1 |
| InChI | InChI=1S/C50H43N3O10S/c1-31(54)61-29-36-30-64-48-41(47(58)53(48)42(36)50(60)63-44(34-21-10-4-11-22-34)35-23-12-5-13-24-35)51-40(55)28-16-27-39(52-45(56)37-25-14-15-26-38(37)46(52)57)49(59)62-43(32-17-6-2-7-18-32)33-19-8-3-9-20-33/h2-15,17-26,39,41,43-44,48H,16,27-30H2,1H3,(H,51,55)/t39?,41-,48-/m1/s1 |
| InChIKey | AFAGGVJKLRGBNL-DTWDRQABSA-N |
| XLogP | 6.70 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.97 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|