About (E,4S)-4,5-dihydroxypent-2-enal
(E,4S)-4,5-dihydroxypent-2-enal (PubChem CID 131247601) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is (E,4S)-4,5-dihydroxypent-2-enal.
Molecular Properties
| Compound Name | (E,4S)-4,5-dihydroxypent-2-enal |
| PubChem CID | 131247601 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (E,4S)-4,5-dihydroxypent-2-enal |
| SMILES | O=C/C=C/[C@H](O)CO |
| InChI | InChI=1S/C5H8O3/c6-3-1-2-5(8)4-7/h1-3,5,7-8H,4H2/b2-1+/t5-/m0/s1 |
| InChIKey | MERWVFZVBUHPAV-WYPBCBNTSA-N |
| XLogP | -0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-4,5-dihydroxypent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-4,5-dihydroxypent-2-enal?
The IUPAC name of (E,4S)-4,5-dihydroxypent-2-enal (CID 131247601) is (E,4S)-4,5-dihydroxypent-2-enal.
What is the SMILES notation for (E,4S)-4,5-dihydroxypent-2-enal?
The canonical SMILES for (E,4S)-4,5-dihydroxypent-2-enal is O=C/C=C/[C@H](O)CO.
What is the InChIKey of (E,4S)-4,5-dihydroxypent-2-enal?
The InChIKey is MERWVFZVBUHPAV-WYPBCBNTSA-N. The full InChI is InChI=1S/C5H8O3/c6-3-1-2-5(8)4-7/h1-3,5,7-8H,4H2/b2-1+/t5-/m0/s1.
What are the key properties of (E,4S)-4,5-dihydroxypent-2-enal?
(E,4S)-4,5-dihydroxypent-2-enal has a molecular weight of 116.12 g/mol, XLogP of -0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-4,5-dihydroxypent-2-enal is sourced from PubChem (CID 131247601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).