About (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one
(Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one (PubChem CID 131248652) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one |
| PubChem CID | 131248652 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one |
| SMILES | CC[C@@H]1O[C@H]1C/C=C\C(C)=O |
| InChI | InChI=1S/C9H14O2/c1-3-8-9(11-8)6-4-5-7(2)10/h4-5,8-9H,3,6H2,1-2H3/b5-4-/t8-,9-/m0/s1 |
| InChIKey | XSGUMIKFFNJODG-NSVKDGAOSA-N |
| XLogP | 1.70 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one?
The IUPAC name of (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one (CID 131248652) is (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one.
What is the SMILES notation for (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one?
The canonical SMILES for (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one is CC[C@@H]1O[C@H]1C/C=C\C(C)=O.
What is the InChIKey of (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one?
The InChIKey is XSGUMIKFFNJODG-NSVKDGAOSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-8-9(11-8)6-4-5-7(2)10/h4-5,8-9H,3,6H2,1-2H3/b5-4-/t8-,9-/m0/s1.
What are the key properties of (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one?
(Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one has a molecular weight of 154.21 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-[(2S,3S)-3-ethyloxiran-2-yl]pent-3-en-2-one is sourced from PubChem (CID 131248652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).