About 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide
5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide (PubChem CID 13124960) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 13124960 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CSCc1cc(C(N)=O)no1 |
| InChI | InChI=1S/C6H8N2O2S/c1-11-3-4-2-5(6(7)9)8-10-4/h2H,3H2,1H3,(H2,7,9) |
| InChIKey | NHGDGTBPTCFUHT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide (CID 13124960) is 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide is CSCc1cc(C(N)=O)no1.
What is the InChIKey of 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is NHGDGTBPTCFUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-11-3-4-2-5(6(7)9)8-10-4/h2H,3H2,1H3,(H2,7,9).
What are the key properties of 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide?
5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 172.21 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylsulfanylmethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 13124960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).