C13H16N2O — CID 13125422
(1Z)-4,4-dimethyl-1-(1-phenylpropan-2-ylidene)diazet-1-ium-3-olate (PubChem CID 13125422) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1Z)-4,4-dimethyl-1-(1-phenylpropan-2-ylidene)diazet-1-ium-3-olate.
| Compound Name | (1Z)-4,4-dimethyl-1-(1-phenylpropan-2-ylidene)diazet-1-ium-3-olate |
|---|---|
| PubChem CID | 13125422 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1Z)-4,4-dimethyl-1-(1-phenylpropan-2-ylidene)diazet-1-ium-3-olate |
| SMILES | C/C(Cc1ccccc1)=[N+]1/N=C([O-])C1(C)C |
| InChI | InChI=1S/C13H16N2O/c1-10(9-11-7-5-4-6-8-11)15-13(2,3)12(16)14-15/h4-8H,9H2,1-3H3/b15-10- |
| InChIKey | FZMDDIPWZJHAJA-GDNBJRDFSA-N |
| XLogP | 1.17 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|