About 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole
4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole (PubChem CID 13125623) has the molecular formula C19H20N6
and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole.
Molecular Properties
| Compound Name | 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole |
| PubChem CID | 13125623 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole |
| SMILES | CC(C)(C)C(N=[N+]=[N-])(c1ccccc1)c1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N6/c1-18(2,3)19(23-24-20,15-12-8-5-9-13-15)17-16(21-25-22-17)14-10-6-4-7-11-14/h4-13H,1-3H3,(H,21,22,25) |
| InChIKey | XMQRVHHPBQYMRN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole?
The IUPAC name of 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole (CID 13125623) is 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole.
What is the SMILES notation for 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole?
The canonical SMILES for 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole is CC(C)(C)C(N=[N+]=[N-])(c1ccccc1)c1n[nH]nc1-c1ccccc1.
What is the InChIKey of 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole?
The InChIKey is XMQRVHHPBQYMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6/c1-18(2,3)19(23-24-20,15-12-8-5-9-13-15)17-16(21-25-22-17)14-10-6-4-7-11-14/h4-13H,1-3H3,(H,21,22,25).
What are the key properties of 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole?
4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole has a molecular weight of 332.41 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-azido-2,2-dimethyl-1-phenylpropyl)-5-phenyl-2H-triazole is sourced from PubChem (CID 13125623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).